C18H26N2O — CID 63129026
(4-ethylpiperidin-4-yl)-(3-phenylpyrrolidin-1-yl)methanone (PubChem CID 63129026) has the molecular formula C18H26N2O and a molecular weight of 286.42 g/mol. Its IUPAC name is (4-ethylpiperidin-4-yl)-(3-phenylpyrrolidin-1-yl)methanone.
| Compound Name | (4-ethylpiperidin-4-yl)-(3-phenylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 63129026 |
| Molecular Formula | C18H26N2O |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | (4-ethylpiperidin-4-yl)-(3-phenylpyrrolidin-1-yl)methanone |
| SMILES | CCC1(C(=O)N2CCC(c3ccccc3)C2)CCNCC1 |
| InChI | InChI=1S/C18H26N2O/c1-2-18(9-11-19-12-10-18)17(21)20-13-8-16(14-20)15-6-4-3-5-7-15/h3-7,16,19H,2,8-14H2,1H3 |
| InChIKey | VBMWHAYLCDWMSO-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |