C13H16ClFN2O — CID 63130654
N-(4-chloro-3-fluorophenyl)-3-methylpiperidine-3-carboxamide (PubChem CID 63130654) has the molecular formula C13H16ClFN2O and a molecular weight of 270.73 g/mol. Its IUPAC name is N-(4-chloro-3-fluorophenyl)-3-methylpiperidine-3-carboxamide.
| Compound Name | N-(4-chloro-3-fluorophenyl)-3-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 63130654 |
| Molecular Formula | C13H16ClFN2O |
| Molecular Weight | 270.73 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | N-(4-chloro-3-fluorophenyl)-3-methylpiperidine-3-carboxamide |
| SMILES | CC1(C(=O)Nc2ccc(Cl)c(F)c2)CCCNC1 |
| InChI | InChI=1S/C13H16ClFN2O/c1-13(5-2-6-16-8-13)12(18)17-9-3-4-10(14)11(15)7-9/h3-4,7,16H,2,5-6,8H2,1H3,(H,17,18) |
| InChIKey | MXAJWWVOXWZIJT-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.73 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |