C16H24N2O2 — CID 63130701
3-ethyl-N-(3-hydroxy-2,4-dimethylphenyl)piperidine-3-carboxamide (PubChem CID 63130701) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is 3-ethyl-N-(3-hydroxy-2,4-dimethylphenyl)piperidine-3-carboxamide.
| Compound Name | 3-ethyl-N-(3-hydroxy-2,4-dimethylphenyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 63130701 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 3-ethyl-N-(3-hydroxy-2,4-dimethylphenyl)piperidine-3-carboxamide |
| SMILES | CCC1(C(=O)Nc2ccc(C)c(O)c2C)CCCNC1 |
| InChI | InChI=1S/C16H24N2O2/c1-4-16(8-5-9-17-10-16)15(20)18-13-7-6-11(2)14(19)12(13)3/h6-7,17,19H,4-5,8-10H2,1-3H3,(H,18,20) |
| InChIKey | KSXRZMSBLIZKJC-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |