C11H22N2O3S — CID 63131031
3-ethyl-N-(2-methylsulfonylethyl)piperidine-3-carboxamide (PubChem CID 63131031) has the molecular formula C11H22N2O3S and a molecular weight of 262.37 g/mol. Its IUPAC name is 3-ethyl-N-(2-methylsulfonylethyl)piperidine-3-carboxamide.
| Compound Name | 3-ethyl-N-(2-methylsulfonylethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 63131031 |
| Molecular Formula | C11H22N2O3S |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 3-ethyl-N-(2-methylsulfonylethyl)piperidine-3-carboxamide |
| SMILES | CCC1(C(=O)NCCS(C)(=O)=O)CCCNC1 |
| InChI | InChI=1S/C11H22N2O3S/c1-3-11(5-4-6-12-9-11)10(14)13-7-8-17(2,15)16/h12H,3-9H2,1-2H3,(H,13,14) |
| InChIKey | KYANVRDGWSATDK-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |