C19H12N4OS — CID 631317
13-(furan-2-yl)-11-phenyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine (PubChem CID 631317) has the molecular formula C19H12N4OS and a molecular weight of 344.40 g/mol. Its IUPAC name is 13-(furan-2-yl)-11-phenyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine.
| Compound Name | 13-(furan-2-yl)-11-phenyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine |
|---|---|
| PubChem CID | 631317 |
| Molecular Formula | C19H12N4OS |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 13-(furan-2-yl)-11-phenyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine |
| SMILES | Nc1ncnc2c1sc1nc(-c3ccccc3)cc(-c3ccco3)c12 |
| InChI | InChI=1S/C19H12N4OS/c20-18-17-16(21-10-22-18)15-12(14-7-4-8-24-14)9-13(23-19(15)25-17)11-5-2-1-3-6-11/h1-10H,(H2,20,21,22) |
| InChIKey | BTUYRLYGCVKCMA-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |