C13H21N3OS — CID 63134919
3-propyl-N-(1,3-thiazol-2-ylmethyl)piperidine-3-carboxamide (PubChem CID 63134919) has the molecular formula C13H21N3OS and a molecular weight of 267.40 g/mol. Its IUPAC name is 3-propyl-N-(1,3-thiazol-2-ylmethyl)piperidine-3-carboxamide.
| Compound Name | 3-propyl-N-(1,3-thiazol-2-ylmethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 63134919 |
| Molecular Formula | C13H21N3OS |
| Molecular Weight | 267.40 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 3-propyl-N-(1,3-thiazol-2-ylmethyl)piperidine-3-carboxamide |
| SMILES | CCCC1(C(=O)NCc2nccs2)CCCNC1 |
| InChI | InChI=1S/C13H21N3OS/c1-2-4-13(5-3-6-14-10-13)12(17)16-9-11-15-7-8-18-11/h7-8,14H,2-6,9-10H2,1H3,(H,16,17) |
| InChIKey | FVCLGFWIGSBXDN-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.40 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |