C16H22ClNO3 — CID 63137041
1-[2-(3-chlorophenoxy)ethyl]-3-ethylpiperidine-3-carboxylic acid (PubChem CID 63137041) has the molecular formula C16H22ClNO3 and a molecular weight of 311.81 g/mol. Its IUPAC name is 1-[2-(3-chlorophenoxy)ethyl]-3-ethylpiperidine-3-carboxylic acid.
| Compound Name | 1-[2-(3-chlorophenoxy)ethyl]-3-ethylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 63137041 |
| Molecular Formula | C16H22ClNO3 |
| Molecular Weight | 311.81 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 1-[2-(3-chlorophenoxy)ethyl]-3-ethylpiperidine-3-carboxylic acid |
| SMILES | CCC1(C(=O)O)CCCN(CCOc2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C16H22ClNO3/c1-2-16(15(19)20)7-4-8-18(12-16)9-10-21-14-6-3-5-13(17)11-14/h3,5-6,11H,2,4,7-10,12H2,1H3,(H,19,20) |
| InChIKey | ICXFLTYHDFXLJB-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.81 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |