About 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-methylpiperidine-3-carboxylic acid
1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-methylpiperidine-3-carboxylic acid (PubChem CID 63137591) has the molecular formula C15H24N2O3
and a molecular weight of 280.37 g/mol. Its IUPAC name is 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-methylpiperidine-3-carboxylic acid.
Molecular Properties
| Compound Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-methylpiperidine-3-carboxylic acid |
| PubChem CID | 63137591 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-methylpiperidine-3-carboxylic acid |
| SMILES | CC1(C(=O)O)CCCN(Cc2ncc(C(C)(C)C)o2)C1 |
| InChI | InChI=1S/C15H24N2O3/c1-14(2,3)11-8-16-12(20-11)9-17-7-5-6-15(4,10-17)13(18)19/h8H,5-7,9-10H2,1-4H3,(H,18,19) |
| InChIKey | IZUKEFWRSWRGDT-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 66.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-methylpiperidine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-methylpiperidine-3-carboxylic acid?
The IUPAC name of 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-methylpiperidine-3-carboxylic acid (CID 63137591) is 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-methylpiperidine-3-carboxylic acid.
What is the SMILES notation for 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-methylpiperidine-3-carboxylic acid?
The canonical SMILES for 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-methylpiperidine-3-carboxylic acid is CC1(C(=O)O)CCCN(Cc2ncc(C(C)(C)C)o2)C1.
What is the InChIKey of 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-methylpiperidine-3-carboxylic acid?
The InChIKey is IZUKEFWRSWRGDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2O3/c1-14(2,3)11-8-16-12(20-11)9-17-7-5-6-15(4,10-17)13(18)19/h8H,5-7,9-10H2,1-4H3,(H,18,19).
What are the key properties of 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-methylpiperidine-3-carboxylic acid?
1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-methylpiperidine-3-carboxylic acid has a molecular weight of 280.37 g/mol, XLogP of 2.66, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-methylpiperidine-3-carboxylic acid is sourced from PubChem (CID 63137591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).