C14H21N3O3S — CID 63139281
N-(2,3-dimethyl-5-sulfamoylphenyl)-3-methylpyrrolidine-3-carboxamide (PubChem CID 63139281) has the molecular formula C14H21N3O3S and a molecular weight of 311.41 g/mol. Its IUPAC name is N-(2,3-dimethyl-5-sulfamoylphenyl)-3-methylpyrrolidine-3-carboxamide.
| Compound Name | N-(2,3-dimethyl-5-sulfamoylphenyl)-3-methylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 63139281 |
| Molecular Formula | C14H21N3O3S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | N-(2,3-dimethyl-5-sulfamoylphenyl)-3-methylpyrrolidine-3-carboxamide |
| SMILES | Cc1cc(S(N)(=O)=O)cc(NC(=O)C2(C)CCNC2)c1C |
| InChI | InChI=1S/C14H21N3O3S/c1-9-6-11(21(15,19)20)7-12(10(9)2)17-13(18)14(3)4-5-16-8-14/h6-7,16H,4-5,8H2,1-3H3,(H,17,18)(H2,15,19,20) |
| InChIKey | OREUUHMACNUBFC-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |