C16H21N3O — CID 63140125
N-[(3-cyanophenyl)methyl]-3-propylpyrrolidine-3-carboxamide (PubChem CID 63140125) has the molecular formula C16H21N3O and a molecular weight of 271.36 g/mol. Its IUPAC name is N-[(3-cyanophenyl)methyl]-3-propylpyrrolidine-3-carboxamide.
| Compound Name | N-[(3-cyanophenyl)methyl]-3-propylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 63140125 |
| Molecular Formula | C16H21N3O |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | N-[(3-cyanophenyl)methyl]-3-propylpyrrolidine-3-carboxamide |
| SMILES | CCCC1(C(=O)NCc2cccc(C#N)c2)CCNC1 |
| InChI | InChI=1S/C16H21N3O/c1-2-6-16(7-8-18-12-16)15(20)19-11-14-5-3-4-13(9-14)10-17/h3-5,9,18H,2,6-8,11-12H2,1H3,(H,19,20) |
| InChIKey | CTGYRKDIOCALLE-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |