C14H17Cl3N2O — CID 63140733
3-propyl-N-(2,4,5-trichlorophenyl)pyrrolidine-3-carboxamide (PubChem CID 63140733) has the molecular formula C14H17Cl3N2O and a molecular weight of 335.66 g/mol. Its IUPAC name is 3-propyl-N-(2,4,5-trichlorophenyl)pyrrolidine-3-carboxamide.
| Compound Name | 3-propyl-N-(2,4,5-trichlorophenyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 63140733 |
| Molecular Formula | C14H17Cl3N2O |
| Molecular Weight | 335.66 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | 3-propyl-N-(2,4,5-trichlorophenyl)pyrrolidine-3-carboxamide |
| SMILES | CCCC1(C(=O)Nc2cc(Cl)c(Cl)cc2Cl)CCNC1 |
| InChI | InChI=1S/C14H17Cl3N2O/c1-2-3-14(4-5-18-8-14)13(20)19-12-7-10(16)9(15)6-11(12)17/h6-7,18H,2-5,8H2,1H3,(H,19,20) |
| InChIKey | CMAQPQJFJCQJQP-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.66 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|