C14H19BrN2O — CID 63141717
N-[(2-bromophenyl)methyl]-3-ethylpyrrolidine-3-carboxamide (PubChem CID 63141717) has the molecular formula C14H19BrN2O and a molecular weight of 311.22 g/mol. Its IUPAC name is N-[(2-bromophenyl)methyl]-3-ethylpyrrolidine-3-carboxamide.
| Compound Name | N-[(2-bromophenyl)methyl]-3-ethylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 63141717 |
| Molecular Formula | C14H19BrN2O |
| Molecular Weight | 311.22 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | N-[(2-bromophenyl)methyl]-3-ethylpyrrolidine-3-carboxamide |
| SMILES | CCC1(C(=O)NCc2ccccc2Br)CCNC1 |
| InChI | InChI=1S/C14H19BrN2O/c1-2-14(7-8-16-10-14)13(18)17-9-11-5-3-4-6-12(11)15/h3-6,16H,2,7-10H2,1H3,(H,17,18) |
| InChIKey | MYNJERGIGLNMIZ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.22 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |