About 4-[(3-ethylpyrrolidin-3-yl)methyl]-2,5-dimethylmorpholine
4-[(3-ethylpyrrolidin-3-yl)methyl]-2,5-dimethylmorpholine (PubChem CID 63142734) has the molecular formula C13H26N2O
and a molecular weight of 226.36 g/mol. Its IUPAC name is 4-[(3-ethylpyrrolidin-3-yl)methyl]-2,5-dimethylmorpholine.
Molecular Properties
| Compound Name | 4-[(3-ethylpyrrolidin-3-yl)methyl]-2,5-dimethylmorpholine |
| PubChem CID | 63142734 |
| Molecular Formula | C13H26N2O |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.20 |
| IUPAC Name | 4-[(3-ethylpyrrolidin-3-yl)methyl]-2,5-dimethylmorpholine |
| SMILES | CCC1(CN2CC(C)OCC2C)CCNC1 |
| InChI | InChI=1S/C13H26N2O/c1-4-13(5-6-14-9-13)10-15-7-12(3)16-8-11(15)2/h11-12,14H,4-10H2,1-3H3 |
| InChIKey | XPYDIOHHOWVGQE-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[(3-ethylpyrrolidin-3-yl)methyl]-2,5-dimethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3-ethylpyrrolidin-3-yl)methyl]-2,5-dimethylmorpholine?
The IUPAC name of 4-[(3-ethylpyrrolidin-3-yl)methyl]-2,5-dimethylmorpholine (CID 63142734) is 4-[(3-ethylpyrrolidin-3-yl)methyl]-2,5-dimethylmorpholine.
What is the SMILES notation for 4-[(3-ethylpyrrolidin-3-yl)methyl]-2,5-dimethylmorpholine?
The canonical SMILES for 4-[(3-ethylpyrrolidin-3-yl)methyl]-2,5-dimethylmorpholine is CCC1(CN2CC(C)OCC2C)CCNC1.
What is the InChIKey of 4-[(3-ethylpyrrolidin-3-yl)methyl]-2,5-dimethylmorpholine?
The InChIKey is XPYDIOHHOWVGQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2O/c1-4-13(5-6-14-9-13)10-15-7-12(3)16-8-11(15)2/h11-12,14H,4-10H2,1-3H3.
What are the key properties of 4-[(3-ethylpyrrolidin-3-yl)methyl]-2,5-dimethylmorpholine?
4-[(3-ethylpyrrolidin-3-yl)methyl]-2,5-dimethylmorpholine has a molecular weight of 226.36 g/mol, XLogP of 1.49, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3-ethylpyrrolidin-3-yl)methyl]-2,5-dimethylmorpholine is sourced from PubChem (CID 63142734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).