About 3-methyl-1-(3,3,3-trifluoropropanoyl)pyrrolidine-3-carboxylic acid
3-methyl-1-(3,3,3-trifluoropropanoyl)pyrrolidine-3-carboxylic acid (PubChem CID 63142773) has the molecular formula C9H12F3NO3
and a molecular weight of 239.19 g/mol. Its IUPAC name is 3-methyl-1-(3,3,3-trifluoropropanoyl)pyrrolidine-3-carboxylic acid.
Molecular Properties
| Compound Name | 3-methyl-1-(3,3,3-trifluoropropanoyl)pyrrolidine-3-carboxylic acid |
| PubChem CID | 63142773 |
| Molecular Formula | C9H12F3NO3 |
| Molecular Weight | 239.19 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | 3-methyl-1-(3,3,3-trifluoropropanoyl)pyrrolidine-3-carboxylic acid |
| SMILES | CC1(C(=O)O)CCN(C(=O)CC(F)(F)F)C1 |
| InChI | InChI=1S/C9H12F3NO3/c1-8(7(15)16)2-3-13(5-8)6(14)4-9(10,11)12/h2-5H2,1H3,(H,15,16) |
| InChIKey | GLKYWFOLGQRTJL-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.19 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methyl-1-(3,3,3-trifluoropropanoyl)pyrrolidine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1-(3,3,3-trifluoropropanoyl)pyrrolidine-3-carboxylic acid?
The IUPAC name of 3-methyl-1-(3,3,3-trifluoropropanoyl)pyrrolidine-3-carboxylic acid (CID 63142773) is 3-methyl-1-(3,3,3-trifluoropropanoyl)pyrrolidine-3-carboxylic acid.
What is the SMILES notation for 3-methyl-1-(3,3,3-trifluoropropanoyl)pyrrolidine-3-carboxylic acid?
The canonical SMILES for 3-methyl-1-(3,3,3-trifluoropropanoyl)pyrrolidine-3-carboxylic acid is CC1(C(=O)O)CCN(C(=O)CC(F)(F)F)C1.
What is the InChIKey of 3-methyl-1-(3,3,3-trifluoropropanoyl)pyrrolidine-3-carboxylic acid?
The InChIKey is GLKYWFOLGQRTJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12F3NO3/c1-8(7(15)16)2-3-13(5-8)6(14)4-9(10,11)12/h2-5H2,1H3,(H,15,16).
What are the key properties of 3-methyl-1-(3,3,3-trifluoropropanoyl)pyrrolidine-3-carboxylic acid?
3-methyl-1-(3,3,3-trifluoropropanoyl)pyrrolidine-3-carboxylic acid has a molecular weight of 239.19 g/mol, XLogP of 1.26, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1-(3,3,3-trifluoropropanoyl)pyrrolidine-3-carboxylic acid is sourced from PubChem (CID 63142773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).