C12H24N4O3S — CID 63143423
1-(3-methylpyrrolidine-3-carbonyl)-3-[(sulfamoylamino)methyl]piperidine (PubChem CID 63143423) has the molecular formula C12H24N4O3S and a molecular weight of 304.42 g/mol. Its IUPAC name is 1-(3-methylpyrrolidine-3-carbonyl)-3-[(sulfamoylamino)methyl]piperidine.
| Compound Name | 1-(3-methylpyrrolidine-3-carbonyl)-3-[(sulfamoylamino)methyl]piperidine |
|---|---|
| PubChem CID | 63143423 |
| Molecular Formula | C12H24N4O3S |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 1-(3-methylpyrrolidine-3-carbonyl)-3-[(sulfamoylamino)methyl]piperidine |
| SMILES | CC1(C(=O)N2CCCC(CNS(N)(=O)=O)C2)CCNC1 |
| InChI | InChI=1S/C12H24N4O3S/c1-12(4-5-14-9-12)11(17)16-6-2-3-10(8-16)7-15-20(13,18)19/h10,14-15H,2-9H2,1H3,(H2,13,18,19) |
| InChIKey | IYEDAHQXMZNZJN-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |