C17H25N3 — CID 63144404
2-(3-ethylpyrrolidin-3-yl)-5-methyl-1-propan-2-ylbenzimidazole (PubChem CID 63144404) has the molecular formula C17H25N3 and a molecular weight of 271.41 g/mol. Its IUPAC name is 2-(3-ethylpyrrolidin-3-yl)-5-methyl-1-propan-2-ylbenzimidazole.
| Compound Name | 2-(3-ethylpyrrolidin-3-yl)-5-methyl-1-propan-2-ylbenzimidazole |
|---|---|
| PubChem CID | 63144404 |
| Molecular Formula | C17H25N3 |
| Molecular Weight | 271.41 g/mol |
| Exact Mass | 271.20 |
| IUPAC Name | 2-(3-ethylpyrrolidin-3-yl)-5-methyl-1-propan-2-ylbenzimidazole |
| SMILES | CCC1(c2nc3cc(C)ccc3n2C(C)C)CCNC1 |
| InChI | InChI=1S/C17H25N3/c1-5-17(8-9-18-11-17)16-19-14-10-13(4)6-7-15(14)20(16)12(2)3/h6-7,10,12,18H,5,8-9,11H2,1-4H3 |
| InChIKey | YXTQSVOJVRHQNY-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.41 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |