C21H30O4 — CID 631449
4,4,13-trimethyl-3,17-dioxo-1,2,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-10-carboxylic acid (PubChem CID 631449) has the molecular formula C21H30O4 and a molecular weight of 346.47 g/mol. Its IUPAC name is 4,4,13-trimethyl-3,17-dioxo-1,2,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-10-carboxylic acid.
| Compound Name | 4,4,13-trimethyl-3,17-dioxo-1,2,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-10-carboxylic acid |
|---|---|
| PubChem CID | 631449 |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | 4,4,13-trimethyl-3,17-dioxo-1,2,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-10-carboxylic acid |
| SMILES | CC1(C)C(=O)CCC2(C(=O)O)C3CCC4(C)C(=O)CCC4C3CCC12 |
| InChI | InChI=1S/C21H30O4/c1-19(2)15-6-4-12-13-5-7-17(23)20(13,3)10-8-14(12)21(15,18(24)25)11-9-16(19)22/h12-15H,4-11H2,1-3H3,(H,24,25) |
| InChIKey | SLROTJYGPHGJGI-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |