C15H22N2O3S — CID 63145705
3-propyl-1-(2-thiophen-2-ylethylcarbamoyl)pyrrolidine-3-carboxylic acid (PubChem CID 63145705) has the molecular formula C15H22N2O3S and a molecular weight of 310.42 g/mol. Its IUPAC name is 3-propyl-1-(2-thiophen-2-ylethylcarbamoyl)pyrrolidine-3-carboxylic acid.
| Compound Name | 3-propyl-1-(2-thiophen-2-ylethylcarbamoyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 63145705 |
| Molecular Formula | C15H22N2O3S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 3-propyl-1-(2-thiophen-2-ylethylcarbamoyl)pyrrolidine-3-carboxylic acid |
| SMILES | CCCC1(C(=O)O)CCN(C(=O)NCCc2cccs2)C1 |
| InChI | InChI=1S/C15H22N2O3S/c1-2-6-15(13(18)19)7-9-17(11-15)14(20)16-8-5-12-4-3-10-21-12/h3-4,10H,2,5-9,11H2,1H3,(H,16,20)(H,18,19) |
| InChIKey | PIBYLMDRZLROOQ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |