3-propyl-1-(2,2,2-trifluoroacetyl)pyrrolidine-3-carboxylic acid

C10H14F3NO3 — CID 63145961

IUPAC3-propyl-1-(2,2,2-trifluoroacetyl)pyrrolidine-3-carboxylic acid
SMILESCCCC1(C(=O)O)CCN(C(=O)C(F)(F)F)C1
InChIInChI=1S/C10H14F3NO3/c1-2-3-9(8(16)17)4-5-14(6-9)7(15)10(11,12)13/h2-6H2,1H3,(H,16,17)
InChIKeyXIUIUVBYLGMSMW-UHFFFAOYSA-N
MW253.22 g/mol
LogP1.65
Rot. Bonds3

About 3-propyl-1-(2,2,2-trifluoroacetyl)pyrrolidine-3-carboxylic acid

3-propyl-1-(2,2,2-trifluoroacetyl)pyrrolidine-3-carboxylic acid (PubChem CID 63145961) has the molecular formula C10H14F3NO3 and a molecular weight of 253.22 g/mol. Its IUPAC name is 3-propyl-1-(2,2,2-trifluoroacetyl)pyrrolidine-3-carboxylic acid.

Molecular Properties

Compound Name3-propyl-1-(2,2,2-trifluoroacetyl)pyrrolidine-3-carboxylic acid
PubChem CID63145961
Molecular FormulaC10H14F3NO3
Molecular Weight253.22 g/mol
Exact Mass253.09
IUPAC Name3-propyl-1-(2,2,2-trifluoroacetyl)pyrrolidine-3-carboxylic acid
SMILESCCCC1(C(=O)O)CCN(C(=O)C(F)(F)F)C1
InChIInChI=1S/C10H14F3NO3/c1-2-3-9(8(16)17)4-5-14(6-9)7(15)10(11,12)13/h2-6H2,1H3,(H,16,17)
InChIKeyXIUIUVBYLGMSMW-UHFFFAOYSA-N
XLogP1.65
TPSA57.61 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500253.22
LogP ≤ 51.65
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 3-propyl-1-(2,2,2-trifluoroacetyl)pyrrolidine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-propyl-1-(2,2,2-trifluoroacetyl)pyrrolidine-3-carboxylic acid?
The IUPAC name of 3-propyl-1-(2,2,2-trifluoroacetyl)pyrrolidine-3-carboxylic acid (CID 63145961) is 3-propyl-1-(2,2,2-trifluoroacetyl)pyrrolidine-3-carboxylic acid.
What is the SMILES notation for 3-propyl-1-(2,2,2-trifluoroacetyl)pyrrolidine-3-carboxylic acid?
The canonical SMILES for 3-propyl-1-(2,2,2-trifluoroacetyl)pyrrolidine-3-carboxylic acid is CCCC1(C(=O)O)CCN(C(=O)C(F)(F)F)C1.
What is the InChIKey of 3-propyl-1-(2,2,2-trifluoroacetyl)pyrrolidine-3-carboxylic acid?
The InChIKey is XIUIUVBYLGMSMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14F3NO3/c1-2-3-9(8(16)17)4-5-14(6-9)7(15)10(11,12)13/h2-6H2,1H3,(H,16,17).
What are the key properties of 3-propyl-1-(2,2,2-trifluoroacetyl)pyrrolidine-3-carboxylic acid?
3-propyl-1-(2,2,2-trifluoroacetyl)pyrrolidine-3-carboxylic acid has a molecular weight of 253.22 g/mol, XLogP of 1.65, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propyl-1-(2,2,2-trifluoroacetyl)pyrrolidine-3-carboxylic acid is sourced from PubChem (CID 63145961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).