C12H13BrClNO4S — CID 63145980
1-(4-bromo-2-chlorophenyl)sulfonyl-3-methylpyrrolidine-3-carboxylic acid (PubChem CID 63145980) has the molecular formula C12H13BrClNO4S and a molecular weight of 382.66 g/mol. Its IUPAC name is 1-(4-bromo-2-chlorophenyl)sulfonyl-3-methylpyrrolidine-3-carboxylic acid.
| Compound Name | 1-(4-bromo-2-chlorophenyl)sulfonyl-3-methylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 63145980 |
| Molecular Formula | C12H13BrClNO4S |
| Molecular Weight | 382.66 g/mol |
| Exact Mass | 380.94 |
| IUPAC Name | 1-(4-bromo-2-chlorophenyl)sulfonyl-3-methylpyrrolidine-3-carboxylic acid |
| SMILES | CC1(C(=O)O)CCN(S(=O)(=O)c2ccc(Br)cc2Cl)C1 |
| InChI | InChI=1S/C12H13BrClNO4S/c1-12(11(16)17)4-5-15(7-12)20(18,19)10-3-2-8(13)6-9(10)14/h2-3,6H,4-5,7H2,1H3,(H,16,17) |
| InChIKey | GHAMWDYERSYENF-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.66 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |