C25H18N4OS2 — CID 6314764
(5Z)-3-benzyl-5-[(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 6314764) has the molecular formula C25H18N4OS2 and a molecular weight of 454.58 g/mol. Its IUPAC name is (5Z)-3-benzyl-5-[(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-benzyl-5-[(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 6314764 |
| Molecular Formula | C25H18N4OS2 |
| Molecular Weight | 454.58 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | (5Z)-3-benzyl-5-[(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/c2cn(-c3ccccc3)nc2-c2ccncc2)SC(=S)N1Cc1ccccc1 |
| InChI | InChI=1S/C25H18N4OS2/c30-24-22(32-25(31)28(24)16-18-7-3-1-4-8-18)15-20-17-29(21-9-5-2-6-10-21)27-23(20)19-11-13-26-14-12-19/h1-15,17H,16H2/b22-15- |
| InChIKey | YWFDOLLWGDEYDH-JCMHNJIXSA-N |
| XLogP | 5.34 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.58 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|