C11H18ClNO2 — CID 63148411
1-(2-chloroprop-2-enyl)-3-propylpyrrolidine-3-carboxylic acid (PubChem CID 63148411) has the molecular formula C11H18ClNO2 and a molecular weight of 231.72 g/mol. Its IUPAC name is 1-(2-chloroprop-2-enyl)-3-propylpyrrolidine-3-carboxylic acid.
| Compound Name | 1-(2-chloroprop-2-enyl)-3-propylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 63148411 |
| Molecular Formula | C11H18ClNO2 |
| Molecular Weight | 231.72 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 1-(2-chloroprop-2-enyl)-3-propylpyrrolidine-3-carboxylic acid |
| SMILES | C=C(Cl)CN1CCC(CCC)(C(=O)O)C1 |
| InChI | InChI=1S/C11H18ClNO2/c1-3-4-11(10(14)15)5-6-13(8-11)7-9(2)12/h2-8H2,1H3,(H,14,15) |
| InChIKey | UUBFIJKKIPYYKE-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.72 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |