C11H15N7O — CID 63149898
2-[(2-aminophenyl)methyl-(1-methyltetrazol-5-yl)amino]acetamide (PubChem CID 63149898) has the molecular formula C11H15N7O and a molecular weight of 261.29 g/mol. Its IUPAC name is 2-[(2-aminophenyl)methyl-(1-methyltetrazol-5-yl)amino]acetamide.
| Compound Name | 2-[(2-aminophenyl)methyl-(1-methyltetrazol-5-yl)amino]acetamide |
|---|---|
| PubChem CID | 63149898 |
| Molecular Formula | C11H15N7O |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 2-[(2-aminophenyl)methyl-(1-methyltetrazol-5-yl)amino]acetamide |
| SMILES | Cn1nnnc1N(CC(N)=O)Cc1ccccc1N |
| InChI | InChI=1S/C11H15N7O/c1-17-11(14-15-16-17)18(7-10(13)19)6-8-4-2-3-5-9(8)12/h2-5H,6-7,12H2,1H3,(H2,13,19) |
| InChIKey | HXIAFMQXXLALLS-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 115.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|