About N'-(2-methylpropyl)-N'-(1-methyltetrazol-5-yl)ethane-1,2-diamine
N'-(2-methylpropyl)-N'-(1-methyltetrazol-5-yl)ethane-1,2-diamine (PubChem CID 63150103) has the molecular formula C8H18N6
and a molecular weight of 198.27 g/mol. Its IUPAC name is N'-(2-methylpropyl)-N'-(1-methyltetrazol-5-yl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-(2-methylpropyl)-N'-(1-methyltetrazol-5-yl)ethane-1,2-diamine |
| PubChem CID | 63150103 |
| Molecular Formula | C8H18N6 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | N'-(2-methylpropyl)-N'-(1-methyltetrazol-5-yl)ethane-1,2-diamine |
| SMILES | CC(C)CN(CCN)c1nnnn1C |
| InChI | InChI=1S/C8H18N6/c1-7(2)6-14(5-4-9)8-10-11-12-13(8)3/h7H,4-6,9H2,1-3H3 |
| InChIKey | LNHCUACZKBOXCO-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N'-(2-methylpropyl)-N'-(1-methyltetrazol-5-yl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2-methylpropyl)-N'-(1-methyltetrazol-5-yl)ethane-1,2-diamine?
The IUPAC name of N'-(2-methylpropyl)-N'-(1-methyltetrazol-5-yl)ethane-1,2-diamine (CID 63150103) is N'-(2-methylpropyl)-N'-(1-methyltetrazol-5-yl)ethane-1,2-diamine.
What is the SMILES notation for N'-(2-methylpropyl)-N'-(1-methyltetrazol-5-yl)ethane-1,2-diamine?
The canonical SMILES for N'-(2-methylpropyl)-N'-(1-methyltetrazol-5-yl)ethane-1,2-diamine is CC(C)CN(CCN)c1nnnn1C.
What is the InChIKey of N'-(2-methylpropyl)-N'-(1-methyltetrazol-5-yl)ethane-1,2-diamine?
The InChIKey is LNHCUACZKBOXCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N6/c1-7(2)6-14(5-4-9)8-10-11-12-13(8)3/h7H,4-6,9H2,1-3H3.
What are the key properties of N'-(2-methylpropyl)-N'-(1-methyltetrazol-5-yl)ethane-1,2-diamine?
N'-(2-methylpropyl)-N'-(1-methyltetrazol-5-yl)ethane-1,2-diamine has a molecular weight of 198.27 g/mol, XLogP of -0.37, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2-methylpropyl)-N'-(1-methyltetrazol-5-yl)ethane-1,2-diamine is sourced from PubChem (CID 63150103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).