About N'-methyl-N-(1-methyltetrazol-5-yl)-N'-propan-2-ylbutane-1,4-diamine
N'-methyl-N-(1-methyltetrazol-5-yl)-N'-propan-2-ylbutane-1,4-diamine (PubChem CID 63150397) has the molecular formula C10H22N6
and a molecular weight of 226.33 g/mol. Its IUPAC name is N'-methyl-N-(1-methyltetrazol-5-yl)-N'-propan-2-ylbutane-1,4-diamine.
Molecular Properties
| Compound Name | N'-methyl-N-(1-methyltetrazol-5-yl)-N'-propan-2-ylbutane-1,4-diamine |
| PubChem CID | 63150397 |
| Molecular Formula | C10H22N6 |
| Molecular Weight | 226.33 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | N'-methyl-N-(1-methyltetrazol-5-yl)-N'-propan-2-ylbutane-1,4-diamine |
| SMILES | CC(C)N(C)CCCCNc1nnnn1C |
| InChI | InChI=1S/C10H22N6/c1-9(2)15(3)8-6-5-7-11-10-12-13-14-16(10)4/h9H,5-8H2,1-4H3,(H,11,12,14) |
| InChIKey | HFYMZJNFENKDIG-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.33 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-methyl-N-(1-methyltetrazol-5-yl)-N'-propan-2-ylbutane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-methyl-N-(1-methyltetrazol-5-yl)-N'-propan-2-ylbutane-1,4-diamine?
The IUPAC name of N'-methyl-N-(1-methyltetrazol-5-yl)-N'-propan-2-ylbutane-1,4-diamine (CID 63150397) is N'-methyl-N-(1-methyltetrazol-5-yl)-N'-propan-2-ylbutane-1,4-diamine.
What is the SMILES notation for N'-methyl-N-(1-methyltetrazol-5-yl)-N'-propan-2-ylbutane-1,4-diamine?
The canonical SMILES for N'-methyl-N-(1-methyltetrazol-5-yl)-N'-propan-2-ylbutane-1,4-diamine is CC(C)N(C)CCCCNc1nnnn1C.
What is the InChIKey of N'-methyl-N-(1-methyltetrazol-5-yl)-N'-propan-2-ylbutane-1,4-diamine?
The InChIKey is HFYMZJNFENKDIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N6/c1-9(2)15(3)8-6-5-7-11-10-12-13-14-16(10)4/h9H,5-8H2,1-4H3,(H,11,12,14).
What are the key properties of N'-methyl-N-(1-methyltetrazol-5-yl)-N'-propan-2-ylbutane-1,4-diamine?
N'-methyl-N-(1-methyltetrazol-5-yl)-N'-propan-2-ylbutane-1,4-diamine has a molecular weight of 226.33 g/mol, XLogP of 0.74, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N'-methyl-N-(1-methyltetrazol-5-yl)-N'-propan-2-ylbutane-1,4-diamine is sourced from PubChem (CID 63150397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).