C14H20BrN3 — CID 63150572
2-(1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-2-yl)-5-bromoaniline (PubChem CID 63150572) has the molecular formula C14H20BrN3 and a molecular weight of 310.24 g/mol. Its IUPAC name is 2-(1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-2-yl)-5-bromoaniline.
| Compound Name | 2-(1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-2-yl)-5-bromoaniline |
|---|---|
| PubChem CID | 63150572 |
| Molecular Formula | C14H20BrN3 |
| Molecular Weight | 310.24 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 2-(1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-2-yl)-5-bromoaniline |
| SMILES | Nc1cc(Br)ccc1N1CCCN2CCCC2C1 |
| InChI | InChI=1S/C14H20BrN3/c15-11-4-5-14(13(16)9-11)18-8-2-7-17-6-1-3-12(17)10-18/h4-5,9,12H,1-3,6-8,10,16H2 |
| InChIKey | OSHJITQZLHELGU-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.24 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|