C15H30N4O — CID 63151089
4-(1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-2-yl)-2-(ethylamino)-2-methylbutanamide (PubChem CID 63151089) has the molecular formula C15H30N4O and a molecular weight of 282.43 g/mol. Its IUPAC name is 4-(1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-2-yl)-2-(ethylamino)-2-methylbutanamide.
| Compound Name | 4-(1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-2-yl)-2-(ethylamino)-2-methylbutanamide |
|---|---|
| PubChem CID | 63151089 |
| Molecular Formula | C15H30N4O |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.24 |
| IUPAC Name | 4-(1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-2-yl)-2-(ethylamino)-2-methylbutanamide |
| SMILES | CCNC(C)(CCN1CCCN2CCCC2C1)C(N)=O |
| InChI | InChI=1S/C15H30N4O/c1-3-17-15(2,14(16)20)7-11-18-8-5-10-19-9-4-6-13(19)12-18/h13,17H,3-12H2,1-2H3,(H2,16,20) |
| InChIKey | SBQCUDSUXQTINU-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |