About N'-(2-methylpropyl)-N'-(1-methyltetrazol-5-yl)propane-1,3-diamine
N'-(2-methylpropyl)-N'-(1-methyltetrazol-5-yl)propane-1,3-diamine (PubChem CID 63152217) has the molecular formula C9H20N6
and a molecular weight of 212.30 g/mol. Its IUPAC name is N'-(2-methylpropyl)-N'-(1-methyltetrazol-5-yl)propane-1,3-diamine.
Molecular Properties
| Compound Name | N'-(2-methylpropyl)-N'-(1-methyltetrazol-5-yl)propane-1,3-diamine |
| PubChem CID | 63152217 |
| Molecular Formula | C9H20N6 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.17 |
| IUPAC Name | N'-(2-methylpropyl)-N'-(1-methyltetrazol-5-yl)propane-1,3-diamine |
| SMILES | CC(C)CN(CCCN)c1nnnn1C |
| InChI | InChI=1S/C9H20N6/c1-8(2)7-15(6-4-5-10)9-11-12-13-14(9)3/h8H,4-7,10H2,1-3H3 |
| InChIKey | YRNWPJDOSKIWFP-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N'-(2-methylpropyl)-N'-(1-methyltetrazol-5-yl)propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2-methylpropyl)-N'-(1-methyltetrazol-5-yl)propane-1,3-diamine?
The IUPAC name of N'-(2-methylpropyl)-N'-(1-methyltetrazol-5-yl)propane-1,3-diamine (CID 63152217) is N'-(2-methylpropyl)-N'-(1-methyltetrazol-5-yl)propane-1,3-diamine.
What is the SMILES notation for N'-(2-methylpropyl)-N'-(1-methyltetrazol-5-yl)propane-1,3-diamine?
The canonical SMILES for N'-(2-methylpropyl)-N'-(1-methyltetrazol-5-yl)propane-1,3-diamine is CC(C)CN(CCCN)c1nnnn1C.
What is the InChIKey of N'-(2-methylpropyl)-N'-(1-methyltetrazol-5-yl)propane-1,3-diamine?
The InChIKey is YRNWPJDOSKIWFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N6/c1-8(2)7-15(6-4-5-10)9-11-12-13-14(9)3/h8H,4-7,10H2,1-3H3.
What are the key properties of N'-(2-methylpropyl)-N'-(1-methyltetrazol-5-yl)propane-1,3-diamine?
N'-(2-methylpropyl)-N'-(1-methyltetrazol-5-yl)propane-1,3-diamine has a molecular weight of 212.30 g/mol, XLogP of 0.02, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2-methylpropyl)-N'-(1-methyltetrazol-5-yl)propane-1,3-diamine is sourced from PubChem (CID 63152217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).