About N'-(3-fluorophenyl)-N'-(1-methyltetrazol-5-yl)propane-1,3-diamine
N'-(3-fluorophenyl)-N'-(1-methyltetrazol-5-yl)propane-1,3-diamine (PubChem CID 63152450) has the molecular formula C11H15FN6
and a molecular weight of 250.28 g/mol. Its IUPAC name is N'-(3-fluorophenyl)-N'-(1-methyltetrazol-5-yl)propane-1,3-diamine.
Molecular Properties
| Compound Name | N'-(3-fluorophenyl)-N'-(1-methyltetrazol-5-yl)propane-1,3-diamine |
| PubChem CID | 63152450 |
| Molecular Formula | C11H15FN6 |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | N'-(3-fluorophenyl)-N'-(1-methyltetrazol-5-yl)propane-1,3-diamine |
| SMILES | Cn1nnnc1N(CCCN)c1cccc(F)c1 |
| InChI | InChI=1S/C11H15FN6/c1-17-11(14-15-16-17)18(7-3-6-13)10-5-2-4-9(12)8-10/h2,4-5,8H,3,6-7,13H2,1H3 |
| InChIKey | KNCTVHOZGFCPQY-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N'-(3-fluorophenyl)-N'-(1-methyltetrazol-5-yl)propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(3-fluorophenyl)-N'-(1-methyltetrazol-5-yl)propane-1,3-diamine?
The IUPAC name of N'-(3-fluorophenyl)-N'-(1-methyltetrazol-5-yl)propane-1,3-diamine (CID 63152450) is N'-(3-fluorophenyl)-N'-(1-methyltetrazol-5-yl)propane-1,3-diamine.
What is the SMILES notation for N'-(3-fluorophenyl)-N'-(1-methyltetrazol-5-yl)propane-1,3-diamine?
The canonical SMILES for N'-(3-fluorophenyl)-N'-(1-methyltetrazol-5-yl)propane-1,3-diamine is Cn1nnnc1N(CCCN)c1cccc(F)c1.
What is the InChIKey of N'-(3-fluorophenyl)-N'-(1-methyltetrazol-5-yl)propane-1,3-diamine?
The InChIKey is KNCTVHOZGFCPQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15FN6/c1-17-11(14-15-16-17)18(7-3-6-13)10-5-2-4-9(12)8-10/h2,4-5,8H,3,6-7,13H2,1H3.
What are the key properties of N'-(3-fluorophenyl)-N'-(1-methyltetrazol-5-yl)propane-1,3-diamine?
N'-(3-fluorophenyl)-N'-(1-methyltetrazol-5-yl)propane-1,3-diamine has a molecular weight of 250.28 g/mol, XLogP of 0.84, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(3-fluorophenyl)-N'-(1-methyltetrazol-5-yl)propane-1,3-diamine is sourced from PubChem (CID 63152450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).