C6H14N6 — CID 63152546
N'-(1-methyltetrazol-5-yl)butane-1,4-diamine (PubChem CID 63152546) has the molecular formula C6H14N6 and a molecular weight of 170.22 g/mol. Its IUPAC name is N'-(1-methyltetrazol-5-yl)butane-1,4-diamine.
| Compound Name | N'-(1-methyltetrazol-5-yl)butane-1,4-diamine |
|---|---|
| PubChem CID | 63152546 |
| Molecular Formula | C6H14N6 |
| Molecular Weight | 170.22 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | N'-(1-methyltetrazol-5-yl)butane-1,4-diamine |
| SMILES | Cn1nnnc1NCCCCN |
| InChI | InChI=1S/C6H14N6/c1-12-6(9-10-11-12)8-5-3-2-4-7/h2-5,7H2,1H3,(H,8,9,11) |
| InChIKey | XQLZDMJFESHKJW-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.22 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|