About N'-cycloheptyl-N'-(1-methyltetrazol-5-yl)propane-1,3-diamine
N'-cycloheptyl-N'-(1-methyltetrazol-5-yl)propane-1,3-diamine (PubChem CID 63152591) has the molecular formula C12H24N6
and a molecular weight of 252.37 g/mol. Its IUPAC name is N'-cycloheptyl-N'-(1-methyltetrazol-5-yl)propane-1,3-diamine.
Molecular Properties
| Compound Name | N'-cycloheptyl-N'-(1-methyltetrazol-5-yl)propane-1,3-diamine |
| PubChem CID | 63152591 |
| Molecular Formula | C12H24N6 |
| Molecular Weight | 252.37 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | N'-cycloheptyl-N'-(1-methyltetrazol-5-yl)propane-1,3-diamine |
| SMILES | Cn1nnnc1N(CCCN)C1CCCCCC1 |
| InChI | InChI=1S/C12H24N6/c1-17-12(14-15-16-17)18(10-6-9-13)11-7-4-2-3-5-8-11/h11H,2-10,13H2,1H3 |
| InChIKey | YXWOCIDBNOGYDY-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.37 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N'-cycloheptyl-N'-(1-methyltetrazol-5-yl)propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-cycloheptyl-N'-(1-methyltetrazol-5-yl)propane-1,3-diamine?
The IUPAC name of N'-cycloheptyl-N'-(1-methyltetrazol-5-yl)propane-1,3-diamine (CID 63152591) is N'-cycloheptyl-N'-(1-methyltetrazol-5-yl)propane-1,3-diamine.
What is the SMILES notation for N'-cycloheptyl-N'-(1-methyltetrazol-5-yl)propane-1,3-diamine?
The canonical SMILES for N'-cycloheptyl-N'-(1-methyltetrazol-5-yl)propane-1,3-diamine is Cn1nnnc1N(CCCN)C1CCCCCC1.
What is the InChIKey of N'-cycloheptyl-N'-(1-methyltetrazol-5-yl)propane-1,3-diamine?
The InChIKey is YXWOCIDBNOGYDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N6/c1-17-12(14-15-16-17)18(10-6-9-13)11-7-4-2-3-5-8-11/h11H,2-10,13H2,1H3.
What are the key properties of N'-cycloheptyl-N'-(1-methyltetrazol-5-yl)propane-1,3-diamine?
N'-cycloheptyl-N'-(1-methyltetrazol-5-yl)propane-1,3-diamine has a molecular weight of 252.37 g/mol, XLogP of 1.09, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N'-cycloheptyl-N'-(1-methyltetrazol-5-yl)propane-1,3-diamine is sourced from PubChem (CID 63152591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).