C16H16ClN3S — CID 63152931
5-(chloromethyl)-6-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)imidazo[2,1-b][1,3]thiazole (PubChem CID 63152931) has the molecular formula C16H16ClN3S and a molecular weight of 317.85 g/mol. Its IUPAC name is 5-(chloromethyl)-6-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)imidazo[2,1-b][1,3]thiazole.
| Compound Name | 5-(chloromethyl)-6-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)imidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 63152931 |
| Molecular Formula | C16H16ClN3S |
| Molecular Weight | 317.85 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 5-(chloromethyl)-6-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)imidazo[2,1-b][1,3]thiazole |
| SMILES | ClCc1c(N2CCCc3ccccc3C2)nc2sccn12 |
| InChI | InChI=1S/C16H16ClN3S/c17-10-14-15(18-16-20(14)8-9-21-16)19-7-3-6-12-4-1-2-5-13(12)11-19/h1-2,4-5,8-9H,3,6-7,10-11H2 |
| InChIKey | NWBCEHKUOCFPKS-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 20.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.85 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|