C23H24FeN2O3 — CID 631536
2-N,3-N-bis(2,6-dimethylphenyl)butane-2,3-diimine;carbon monoxide;iron (PubChem CID 631536) has the molecular formula C23H24FeN2O3 and a molecular weight of 432.30 g/mol. Its IUPAC name is 2-N,3-N-bis(2,6-dimethylphenyl)butane-2,3-diimine;carbon monoxide;iron.
| Compound Name | 2-N,3-N-bis(2,6-dimethylphenyl)butane-2,3-diimine;carbon monoxide;iron |
|---|---|
| PubChem CID | 631536 |
| Molecular Formula | C23H24FeN2O3 |
| Molecular Weight | 432.30 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | 2-N,3-N-bis(2,6-dimethylphenyl)butane-2,3-diimine;carbon monoxide;iron |
| SMILES | CC(=N\c1c(C)cccc1C)/C(C)=N/c1c(C)cccc1C.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Fe] |
| InChI | InChI=1S/C20H24N2.3CO.Fe/c1-13-9-7-10-14(2)19(13)21-17(5)18(6)22-20-15(3)11-8-12-16(20)4;3*1-2;/h7-12H,1-6H3;;;;/b21-17+,22-18+;;;; |
| InChIKey | OIHKKXUQYLWRNU-MEQINSKWSA-N |
| XLogP | 5.69 |
| TPSA | 84.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.30 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|