C10H12N4O4 — CID 63154469
5-[2-(carbamoylamino)propanoylamino]pyridine-3-carboxylic acid (PubChem CID 63154469) has the molecular formula C10H12N4O4 and a molecular weight of 252.23 g/mol. Its IUPAC name is 5-[2-(carbamoylamino)propanoylamino]pyridine-3-carboxylic acid.
| Compound Name | 5-[2-(carbamoylamino)propanoylamino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 63154469 |
| Molecular Formula | C10H12N4O4 |
| Molecular Weight | 252.23 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 5-[2-(carbamoylamino)propanoylamino]pyridine-3-carboxylic acid |
| SMILES | CC(NC(N)=O)C(=O)Nc1cncc(C(=O)O)c1 |
| InChI | InChI=1S/C10H12N4O4/c1-5(13-10(11)18)8(15)14-7-2-6(9(16)17)3-12-4-7/h2-5H,1H3,(H,14,15)(H,16,17)(H3,11,13,18) |
| InChIKey | ILUTVGJINCTNQT-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 134.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.23 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |