5-(2-oxo-1,3-oxazolidin-3-yl)pyridine-3-carboxylic acid

C9H8N2O4 — CID 63154635

IUPAC5-(2-oxo-1,3-oxazolidin-3-yl)pyridine-3-carboxylic acid
SMILESO=C(O)c1cncc(N2CCOC2=O)c1
InChIInChI=1S/C9H8N2O4/c12-8(13)6-3-7(5-10-4-6)11-1-2-15-9(11)14/h3-5H,1-2H2,(H,12,13)
InChIKeyYZVMYLHCIZZZER-UHFFFAOYSA-N
MW208.17 g/mol
LogP0.74
Rot. Bonds2

About 5-(2-oxo-1,3-oxazolidin-3-yl)pyridine-3-carboxylic acid

5-(2-oxo-1,3-oxazolidin-3-yl)pyridine-3-carboxylic acid (PubChem CID 63154635) has the molecular formula C9H8N2O4 and a molecular weight of 208.17 g/mol. Its IUPAC name is 5-(2-oxo-1,3-oxazolidin-3-yl)pyridine-3-carboxylic acid.

Molecular Properties

Compound Name5-(2-oxo-1,3-oxazolidin-3-yl)pyridine-3-carboxylic acid
PubChem CID63154635
Molecular FormulaC9H8N2O4
Molecular Weight208.17 g/mol
Exact Mass208.05
IUPAC Name5-(2-oxo-1,3-oxazolidin-3-yl)pyridine-3-carboxylic acid
SMILESO=C(O)c1cncc(N2CCOC2=O)c1
InChIInChI=1S/C9H8N2O4/c12-8(13)6-3-7(5-10-4-6)11-1-2-15-9(11)14/h3-5H,1-2H2,(H,12,13)
InChIKeyYZVMYLHCIZZZER-UHFFFAOYSA-N
XLogP0.74
TPSA79.73 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500208.17
LogP ≤ 50.74
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 5-(2-oxo-1,3-oxazolidin-3-yl)pyridine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(2-oxo-1,3-oxazolidin-3-yl)pyridine-3-carboxylic acid?
The IUPAC name of 5-(2-oxo-1,3-oxazolidin-3-yl)pyridine-3-carboxylic acid (CID 63154635) is 5-(2-oxo-1,3-oxazolidin-3-yl)pyridine-3-carboxylic acid.
What is the SMILES notation for 5-(2-oxo-1,3-oxazolidin-3-yl)pyridine-3-carboxylic acid?
The canonical SMILES for 5-(2-oxo-1,3-oxazolidin-3-yl)pyridine-3-carboxylic acid is O=C(O)c1cncc(N2CCOC2=O)c1.
What is the InChIKey of 5-(2-oxo-1,3-oxazolidin-3-yl)pyridine-3-carboxylic acid?
The InChIKey is YZVMYLHCIZZZER-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O4/c12-8(13)6-3-7(5-10-4-6)11-1-2-15-9(11)14/h3-5H,1-2H2,(H,12,13).
What are the key properties of 5-(2-oxo-1,3-oxazolidin-3-yl)pyridine-3-carboxylic acid?
5-(2-oxo-1,3-oxazolidin-3-yl)pyridine-3-carboxylic acid has a molecular weight of 208.17 g/mol, XLogP of 0.74, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-oxo-1,3-oxazolidin-3-yl)pyridine-3-carboxylic acid is sourced from PubChem (CID 63154635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).