About 2-(6-methylpiperidin-3-yl)-1,3-dihydroisoindole
2-(6-methylpiperidin-3-yl)-1,3-dihydroisoindole (PubChem CID 63155487) has the molecular formula C14H20N2
and a molecular weight of 216.33 g/mol. Its IUPAC name is 2-(6-methylpiperidin-3-yl)-1,3-dihydroisoindole.
Molecular Properties
| Compound Name | 2-(6-methylpiperidin-3-yl)-1,3-dihydroisoindole |
| PubChem CID | 63155487 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 2-(6-methylpiperidin-3-yl)-1,3-dihydroisoindole |
| SMILES | CC1CCC(N2Cc3ccccc3C2)CN1 |
| InChI | InChI=1S/C14H20N2/c1-11-6-7-14(8-15-11)16-9-12-4-2-3-5-13(12)10-16/h2-5,11,14-15H,6-10H2,1H3 |
| InChIKey | ITHCFGVLOHWION-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(6-methylpiperidin-3-yl)-1,3-dihydroisoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-methylpiperidin-3-yl)-1,3-dihydroisoindole?
The IUPAC name of 2-(6-methylpiperidin-3-yl)-1,3-dihydroisoindole (CID 63155487) is 2-(6-methylpiperidin-3-yl)-1,3-dihydroisoindole.
What is the SMILES notation for 2-(6-methylpiperidin-3-yl)-1,3-dihydroisoindole?
The canonical SMILES for 2-(6-methylpiperidin-3-yl)-1,3-dihydroisoindole is CC1CCC(N2Cc3ccccc3C2)CN1.
What is the InChIKey of 2-(6-methylpiperidin-3-yl)-1,3-dihydroisoindole?
The InChIKey is ITHCFGVLOHWION-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2/c1-11-6-7-14(8-15-11)16-9-12-4-2-3-5-13(12)10-16/h2-5,11,14-15H,6-10H2,1H3.
What are the key properties of 2-(6-methylpiperidin-3-yl)-1,3-dihydroisoindole?
2-(6-methylpiperidin-3-yl)-1,3-dihydroisoindole has a molecular weight of 216.33 g/mol, XLogP of 2.14, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-methylpiperidin-3-yl)-1,3-dihydroisoindole is sourced from PubChem (CID 63155487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).