C16H19ClN2 — CID 63155781
2-(2-chlorophenyl)-N-ethyl-1-(6-methyl-3-pyridinyl)ethanamine (PubChem CID 63155781) has the molecular formula C16H19ClN2 and a molecular weight of 274.80 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N-ethyl-1-(6-methyl-3-pyridinyl)ethanamine.
| Compound Name | 2-(2-chlorophenyl)-N-ethyl-1-(6-methyl-3-pyridinyl)ethanamine |
|---|---|
| PubChem CID | 63155781 |
| Molecular Formula | C16H19ClN2 |
| Molecular Weight | 274.80 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 2-(2-chlorophenyl)-N-ethyl-1-(6-methyl-3-pyridinyl)ethanamine |
| SMILES | CCNC(Cc1ccccc1Cl)c1ccc(C)nc1 |
| InChI | InChI=1S/C16H19ClN2/c1-3-18-16(14-9-8-12(2)19-11-14)10-13-6-4-5-7-15(13)17/h4-9,11,16,18H,3,10H2,1-2H3 |
| InChIKey | UGLFQLSXEFTUFU-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.80 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |