C13H12BrNO4 — CID 63156173
4-(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)piperidine-2,6-dione (PubChem CID 63156173) has the molecular formula C13H12BrNO4 and a molecular weight of 326.15 g/mol. Its IUPAC name is 4-(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)piperidine-2,6-dione.
| Compound Name | 4-(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 63156173 |
| Molecular Formula | C13H12BrNO4 |
| Molecular Weight | 326.15 g/mol |
| Exact Mass | 324.99 |
| IUPAC Name | 4-(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)piperidine-2,6-dione |
| SMILES | O=C1CC(c2cc(Br)c3c(c2)OCCO3)CC(=O)N1 |
| InChI | InChI=1S/C13H12BrNO4/c14-9-3-7(4-10-13(9)19-2-1-18-10)8-5-11(16)15-12(17)6-8/h3-4,8H,1-2,5-6H2,(H,15,16,17) |
| InChIKey | QCYUVQBDIZKSEA-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.15 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|