C15H14BrN3O2 — CID 63158099
2-(5-bromo-3-nitro-2-pyridinyl)-1,3,4,5-tetrahydro-2-benzazepine (PubChem CID 63158099) has the molecular formula C15H14BrN3O2 and a molecular weight of 348.20 g/mol. Its IUPAC name is 2-(5-bromo-3-nitro-2-pyridinyl)-1,3,4,5-tetrahydro-2-benzazepine.
| Compound Name | 2-(5-bromo-3-nitro-2-pyridinyl)-1,3,4,5-tetrahydro-2-benzazepine |
|---|---|
| PubChem CID | 63158099 |
| Molecular Formula | C15H14BrN3O2 |
| Molecular Weight | 348.20 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | 2-(5-bromo-3-nitro-2-pyridinyl)-1,3,4,5-tetrahydro-2-benzazepine |
| SMILES | O=[N+]([O-])c1cc(Br)cnc1N1CCCc2ccccc2C1 |
| InChI | InChI=1S/C15H14BrN3O2/c16-13-8-14(19(20)21)15(17-9-13)18-7-3-6-11-4-1-2-5-12(11)10-18/h1-2,4-5,8-9H,3,6-7,10H2 |
| InChIKey | WINRDOMDTSJURO-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 59.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.20 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|