About 3-[(4,4-diethylpiperidin-1-yl)methyl]pyridine-2-carboximidamide
3-[(4,4-diethylpiperidin-1-yl)methyl]pyridine-2-carboximidamide (PubChem CID 63158312) has the molecular formula C16H26N4
and a molecular weight of 274.41 g/mol. Its IUPAC name is 3-[(4,4-diethylpiperidin-1-yl)methyl]pyridine-2-carboximidamide.
Molecular Properties
| Compound Name | 3-[(4,4-diethylpiperidin-1-yl)methyl]pyridine-2-carboximidamide |
| PubChem CID | 63158312 |
| Molecular Formula | C16H26N4 |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.22 |
| IUPAC Name | 3-[(4,4-diethylpiperidin-1-yl)methyl]pyridine-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1ncccc1CN1CCC(CC)(CC)CC1 |
| InChI | InChI=1S/C16H26N4/c1-3-16(4-2)7-10-20(11-8-16)12-13-6-5-9-19-14(13)15(17)18/h5-6,9H,3-4,7-8,10-12H2,1-2H3,(H3,17,18) |
| InChIKey | YEYOWQUOSNOZRL-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 66.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-[(4,4-diethylpiperidin-1-yl)methyl]pyridine-2-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4,4-diethylpiperidin-1-yl)methyl]pyridine-2-carboximidamide?
The IUPAC name of 3-[(4,4-diethylpiperidin-1-yl)methyl]pyridine-2-carboximidamide (CID 63158312) is 3-[(4,4-diethylpiperidin-1-yl)methyl]pyridine-2-carboximidamide.
What is the SMILES notation for 3-[(4,4-diethylpiperidin-1-yl)methyl]pyridine-2-carboximidamide?
The canonical SMILES for 3-[(4,4-diethylpiperidin-1-yl)methyl]pyridine-2-carboximidamide is [H]/N=C(\N)c1ncccc1CN1CCC(CC)(CC)CC1.
What is the InChIKey of 3-[(4,4-diethylpiperidin-1-yl)methyl]pyridine-2-carboximidamide?
The InChIKey is YEYOWQUOSNOZRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N4/c1-3-16(4-2)7-10-20(11-8-16)12-13-6-5-9-19-14(13)15(17)18/h5-6,9H,3-4,7-8,10-12H2,1-2H3,(H3,17,18).
What are the key properties of 3-[(4,4-diethylpiperidin-1-yl)methyl]pyridine-2-carboximidamide?
3-[(4,4-diethylpiperidin-1-yl)methyl]pyridine-2-carboximidamide has a molecular weight of 274.41 g/mol, XLogP of 2.77, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4,4-diethylpiperidin-1-yl)methyl]pyridine-2-carboximidamide is sourced from PubChem (CID 63158312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).