C18H36N2 — CID 63159689
2-[(4-ethyl-4-methylpiperidin-1-yl)methyl]-4-propan-2-ylcyclohexan-1-amine (PubChem CID 63159689) has the molecular formula C18H36N2 and a molecular weight of 280.50 g/mol. Its IUPAC name is 2-[(4-ethyl-4-methylpiperidin-1-yl)methyl]-4-propan-2-ylcyclohexan-1-amine.
| Compound Name | 2-[(4-ethyl-4-methylpiperidin-1-yl)methyl]-4-propan-2-ylcyclohexan-1-amine |
|---|---|
| PubChem CID | 63159689 |
| Molecular Formula | C18H36N2 |
| Molecular Weight | 280.50 g/mol |
| Exact Mass | 280.29 |
| IUPAC Name | 2-[(4-ethyl-4-methylpiperidin-1-yl)methyl]-4-propan-2-ylcyclohexan-1-amine |
| SMILES | CCC1(C)CCN(CC2CC(C(C)C)CCC2N)CC1 |
| InChI | InChI=1S/C18H36N2/c1-5-18(4)8-10-20(11-9-18)13-16-12-15(14(2)3)6-7-17(16)19/h14-17H,5-13,19H2,1-4H3 |
| InChIKey | BJBHCUBFRULKRN-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.50 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |