C16H29NO3 — CID 63160617
4-(4-ethyl-4-methylpiperidin-1-yl)-2-methyl-4-oxo-2-propan-2-ylbutanoic acid (PubChem CID 63160617) has the molecular formula C16H29NO3 and a molecular weight of 283.41 g/mol. Its IUPAC name is 4-(4-ethyl-4-methylpiperidin-1-yl)-2-methyl-4-oxo-2-propan-2-ylbutanoic acid.
| Compound Name | 4-(4-ethyl-4-methylpiperidin-1-yl)-2-methyl-4-oxo-2-propan-2-ylbutanoic acid |
|---|---|
| PubChem CID | 63160617 |
| Molecular Formula | C16H29NO3 |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | 4-(4-ethyl-4-methylpiperidin-1-yl)-2-methyl-4-oxo-2-propan-2-ylbutanoic acid |
| SMILES | CCC1(C)CCN(C(=O)CC(C)(C(=O)O)C(C)C)CC1 |
| InChI | InChI=1S/C16H29NO3/c1-6-15(4)7-9-17(10-8-15)13(18)11-16(5,12(2)3)14(19)20/h12H,6-11H2,1-5H3,(H,19,20) |
| InChIKey | CYCJXYBWRGCNLC-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |