About N-(2-cyanoethyl)-2-(4,4-diethylpiperidin-1-yl)-N-methylacetamide
N-(2-cyanoethyl)-2-(4,4-diethylpiperidin-1-yl)-N-methylacetamide (PubChem CID 63160697) has the molecular formula C15H27N3O
and a molecular weight of 265.40 g/mol. Its IUPAC name is N-(2-cyanoethyl)-2-(4,4-diethylpiperidin-1-yl)-N-methylacetamide.
Molecular Properties
| Compound Name | N-(2-cyanoethyl)-2-(4,4-diethylpiperidin-1-yl)-N-methylacetamide |
| PubChem CID | 63160697 |
| Molecular Formula | C15H27N3O |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.22 |
| IUPAC Name | N-(2-cyanoethyl)-2-(4,4-diethylpiperidin-1-yl)-N-methylacetamide |
| SMILES | CCC1(CC)CCN(CC(=O)N(C)CCC#N)CC1 |
| InChI | InChI=1S/C15H27N3O/c1-4-15(5-2)7-11-18(12-8-15)13-14(19)17(3)10-6-9-16/h4-8,10-13H2,1-3H3 |
| InChIKey | CJGBTHXZMCXAHJ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2-cyanoethyl)-2-(4,4-diethylpiperidin-1-yl)-N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-cyanoethyl)-2-(4,4-diethylpiperidin-1-yl)-N-methylacetamide?
The IUPAC name of N-(2-cyanoethyl)-2-(4,4-diethylpiperidin-1-yl)-N-methylacetamide (CID 63160697) is N-(2-cyanoethyl)-2-(4,4-diethylpiperidin-1-yl)-N-methylacetamide.
What is the SMILES notation for N-(2-cyanoethyl)-2-(4,4-diethylpiperidin-1-yl)-N-methylacetamide?
The canonical SMILES for N-(2-cyanoethyl)-2-(4,4-diethylpiperidin-1-yl)-N-methylacetamide is CCC1(CC)CCN(CC(=O)N(C)CCC#N)CC1.
What is the InChIKey of N-(2-cyanoethyl)-2-(4,4-diethylpiperidin-1-yl)-N-methylacetamide?
The InChIKey is CJGBTHXZMCXAHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27N3O/c1-4-15(5-2)7-11-18(12-8-15)13-14(19)17(3)10-6-9-16/h4-8,10-13H2,1-3H3.
What are the key properties of N-(2-cyanoethyl)-2-(4,4-diethylpiperidin-1-yl)-N-methylacetamide?
N-(2-cyanoethyl)-2-(4,4-diethylpiperidin-1-yl)-N-methylacetamide has a molecular weight of 265.40 g/mol, XLogP of 2.26, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-cyanoethyl)-2-(4,4-diethylpiperidin-1-yl)-N-methylacetamide is sourced from PubChem (CID 63160697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).