About 3-[(2-chloro-6-fluorophenyl)methyl]-1,1-dioxothiolan-3-ol
3-[(2-chloro-6-fluorophenyl)methyl]-1,1-dioxothiolan-3-ol (PubChem CID 63162425) has the molecular formula C11H12ClFO3S
and a molecular weight of 278.73 g/mol. Its IUPAC name is 3-[(2-chloro-6-fluorophenyl)methyl]-1,1-dioxothiolan-3-ol.
Molecular Properties
| Compound Name | 3-[(2-chloro-6-fluorophenyl)methyl]-1,1-dioxothiolan-3-ol |
| PubChem CID | 63162425 |
| Molecular Formula | C11H12ClFO3S |
| Molecular Weight | 278.73 g/mol |
| Exact Mass | 278.02 |
| IUPAC Name | 3-[(2-chloro-6-fluorophenyl)methyl]-1,1-dioxothiolan-3-ol |
| SMILES | O=S1(=O)CCC(O)(Cc2c(F)cccc2Cl)C1 |
| InChI | InChI=1S/C11H12ClFO3S/c12-9-2-1-3-10(13)8(9)6-11(14)4-5-17(15,16)7-11/h1-3,14H,4-7H2 |
| InChIKey | YTQRDIXRUGQXQN-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.73 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(2-chloro-6-fluorophenyl)methyl]-1,1-dioxothiolan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-chloro-6-fluorophenyl)methyl]-1,1-dioxothiolan-3-ol?
The IUPAC name of 3-[(2-chloro-6-fluorophenyl)methyl]-1,1-dioxothiolan-3-ol (CID 63162425) is 3-[(2-chloro-6-fluorophenyl)methyl]-1,1-dioxothiolan-3-ol.
What is the SMILES notation for 3-[(2-chloro-6-fluorophenyl)methyl]-1,1-dioxothiolan-3-ol?
The canonical SMILES for 3-[(2-chloro-6-fluorophenyl)methyl]-1,1-dioxothiolan-3-ol is O=S1(=O)CCC(O)(Cc2c(F)cccc2Cl)C1.
What is the InChIKey of 3-[(2-chloro-6-fluorophenyl)methyl]-1,1-dioxothiolan-3-ol?
The InChIKey is YTQRDIXRUGQXQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12ClFO3S/c12-9-2-1-3-10(13)8(9)6-11(14)4-5-17(15,16)7-11/h1-3,14H,4-7H2.
What are the key properties of 3-[(2-chloro-6-fluorophenyl)methyl]-1,1-dioxothiolan-3-ol?
3-[(2-chloro-6-fluorophenyl)methyl]-1,1-dioxothiolan-3-ol has a molecular weight of 278.73 g/mol, XLogP of 1.57, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-chloro-6-fluorophenyl)methyl]-1,1-dioxothiolan-3-ol is sourced from PubChem (CID 63162425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).