About 3-(3-fluorophenyl)-1,1-dioxothiolan-3-ol
3-(3-fluorophenyl)-1,1-dioxothiolan-3-ol (PubChem CID 63162678) has the molecular formula C10H11FO3S
and a molecular weight of 230.26 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-1,1-dioxothiolan-3-ol.
Molecular Properties
| Compound Name | 3-(3-fluorophenyl)-1,1-dioxothiolan-3-ol |
| PubChem CID | 63162678 |
| Molecular Formula | C10H11FO3S |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | 3-(3-fluorophenyl)-1,1-dioxothiolan-3-ol |
| SMILES | O=S1(=O)CCC(O)(c2cccc(F)c2)C1 |
| InChI | InChI=1S/C10H11FO3S/c11-9-3-1-2-8(6-9)10(12)4-5-15(13,14)7-10/h1-3,6,12H,4-5,7H2 |
| InChIKey | YAWGRHZICPUVTD-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(3-fluorophenyl)-1,1-dioxothiolan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-fluorophenyl)-1,1-dioxothiolan-3-ol?
The IUPAC name of 3-(3-fluorophenyl)-1,1-dioxothiolan-3-ol (CID 63162678) is 3-(3-fluorophenyl)-1,1-dioxothiolan-3-ol.
What is the SMILES notation for 3-(3-fluorophenyl)-1,1-dioxothiolan-3-ol?
The canonical SMILES for 3-(3-fluorophenyl)-1,1-dioxothiolan-3-ol is O=S1(=O)CCC(O)(c2cccc(F)c2)C1.
What is the InChIKey of 3-(3-fluorophenyl)-1,1-dioxothiolan-3-ol?
The InChIKey is YAWGRHZICPUVTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11FO3S/c11-9-3-1-2-8(6-9)10(12)4-5-15(13,14)7-10/h1-3,6,12H,4-5,7H2.
What are the key properties of 3-(3-fluorophenyl)-1,1-dioxothiolan-3-ol?
3-(3-fluorophenyl)-1,1-dioxothiolan-3-ol has a molecular weight of 230.26 g/mol, XLogP of 0.83, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-fluorophenyl)-1,1-dioxothiolan-3-ol is sourced from PubChem (CID 63162678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).