About 2-(4,4-diethylpiperidin-1-yl)-N-(2-ethoxyethyl)ethanamine
2-(4,4-diethylpiperidin-1-yl)-N-(2-ethoxyethyl)ethanamine (PubChem CID 63163215) has the molecular formula C15H32N2O
and a molecular weight of 256.43 g/mol. Its IUPAC name is 2-(4,4-diethylpiperidin-1-yl)-N-(2-ethoxyethyl)ethanamine.
Molecular Properties
| Compound Name | 2-(4,4-diethylpiperidin-1-yl)-N-(2-ethoxyethyl)ethanamine |
| PubChem CID | 63163215 |
| Molecular Formula | C15H32N2O |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.25 |
| IUPAC Name | 2-(4,4-diethylpiperidin-1-yl)-N-(2-ethoxyethyl)ethanamine |
| SMILES | CCOCCNCCN1CCC(CC)(CC)CC1 |
| InChI | InChI=1S/C15H32N2O/c1-4-15(5-2)7-11-17(12-8-15)13-9-16-10-14-18-6-3/h16H,4-14H2,1-3H3 |
| InChIKey | SNKMJOZECRZLQW-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(4,4-diethylpiperidin-1-yl)-N-(2-ethoxyethyl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,4-diethylpiperidin-1-yl)-N-(2-ethoxyethyl)ethanamine?
The IUPAC name of 2-(4,4-diethylpiperidin-1-yl)-N-(2-ethoxyethyl)ethanamine (CID 63163215) is 2-(4,4-diethylpiperidin-1-yl)-N-(2-ethoxyethyl)ethanamine.
What is the SMILES notation for 2-(4,4-diethylpiperidin-1-yl)-N-(2-ethoxyethyl)ethanamine?
The canonical SMILES for 2-(4,4-diethylpiperidin-1-yl)-N-(2-ethoxyethyl)ethanamine is CCOCCNCCN1CCC(CC)(CC)CC1.
What is the InChIKey of 2-(4,4-diethylpiperidin-1-yl)-N-(2-ethoxyethyl)ethanamine?
The InChIKey is SNKMJOZECRZLQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H32N2O/c1-4-15(5-2)7-11-17(12-8-15)13-9-16-10-14-18-6-3/h16H,4-14H2,1-3H3.
What are the key properties of 2-(4,4-diethylpiperidin-1-yl)-N-(2-ethoxyethyl)ethanamine?
2-(4,4-diethylpiperidin-1-yl)-N-(2-ethoxyethyl)ethanamine has a molecular weight of 256.43 g/mol, XLogP of 2.51, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,4-diethylpiperidin-1-yl)-N-(2-ethoxyethyl)ethanamine is sourced from PubChem (CID 63163215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).