C13H21N3O — CID 63163799
2-[3-(dimethylamino)pyrrolidin-1-yl]-1-(1-methylpyrrol-2-yl)ethanone (PubChem CID 63163799) has the molecular formula C13H21N3O and a molecular weight of 235.33 g/mol. Its IUPAC name is 2-[3-(dimethylamino)pyrrolidin-1-yl]-1-(1-methylpyrrol-2-yl)ethanone.
| Compound Name | 2-[3-(dimethylamino)pyrrolidin-1-yl]-1-(1-methylpyrrol-2-yl)ethanone |
|---|---|
| PubChem CID | 63163799 |
| Molecular Formula | C13H21N3O |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | 2-[3-(dimethylamino)pyrrolidin-1-yl]-1-(1-methylpyrrol-2-yl)ethanone |
| SMILES | CN(C)C1CCN(CC(=O)c2cccn2C)C1 |
| InChI | InChI=1S/C13H21N3O/c1-14(2)11-6-8-16(9-11)10-13(17)12-5-4-7-15(12)3/h4-5,7,11H,6,8-10H2,1-3H3 |
| InChIKey | YDSWUNZWEPYFAG-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |