C11H23N3 — CID 63163808
1-(2-aminocyclopentyl)-N,N-dimethylpyrrolidin-3-amine (PubChem CID 63163808) has the molecular formula C11H23N3 and a molecular weight of 197.33 g/mol. Its IUPAC name is 1-(2-aminocyclopentyl)-N,N-dimethylpyrrolidin-3-amine.
| Compound Name | 1-(2-aminocyclopentyl)-N,N-dimethylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 63163808 |
| Molecular Formula | C11H23N3 |
| Molecular Weight | 197.33 g/mol |
| Exact Mass | 197.19 |
| IUPAC Name | 1-(2-aminocyclopentyl)-N,N-dimethylpyrrolidin-3-amine |
| SMILES | CN(C)C1CCN(C2CCCC2N)C1 |
| InChI | InChI=1S/C11H23N3/c1-13(2)9-6-7-14(8-9)11-5-3-4-10(11)12/h9-11H,3-8,12H2,1-2H3 |
| InChIKey | QWUHFCDFTACBPC-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.33 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |