C17H28BrN3 — CID 63164194
1-[2-bromo-4-[1-(propylamino)ethyl]phenyl]-N,N-dimethylpyrrolidin-3-amine (PubChem CID 63164194) has the molecular formula C17H28BrN3 and a molecular weight of 354.34 g/mol. Its IUPAC name is 1-[2-bromo-4-[1-(propylamino)ethyl]phenyl]-N,N-dimethylpyrrolidin-3-amine.
| Compound Name | 1-[2-bromo-4-[1-(propylamino)ethyl]phenyl]-N,N-dimethylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 63164194 |
| Molecular Formula | C17H28BrN3 |
| Molecular Weight | 354.34 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | 1-[2-bromo-4-[1-(propylamino)ethyl]phenyl]-N,N-dimethylpyrrolidin-3-amine |
| SMILES | CCCNC(C)c1ccc(N2CCC(N(C)C)C2)c(Br)c1 |
| InChI | InChI=1S/C17H28BrN3/c1-5-9-19-13(2)14-6-7-17(16(18)11-14)21-10-8-15(12-21)20(3)4/h6-7,11,13,15,19H,5,8-10,12H2,1-4H3 |
| InChIKey | VHGNWKQTTVNZQU-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.34 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|