C11H25N3O2S — CID 63165498
1-(3-aminopropylsulfonyl)-N,N-diethylpyrrolidin-3-amine (PubChem CID 63165498) has the molecular formula C11H25N3O2S and a molecular weight of 263.41 g/mol. Its IUPAC name is 1-(3-aminopropylsulfonyl)-N,N-diethylpyrrolidin-3-amine.
| Compound Name | 1-(3-aminopropylsulfonyl)-N,N-diethylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 63165498 |
| Molecular Formula | C11H25N3O2S |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 1-(3-aminopropylsulfonyl)-N,N-diethylpyrrolidin-3-amine |
| SMILES | CCN(CC)C1CCN(S(=O)(=O)CCCN)C1 |
| InChI | InChI=1S/C11H25N3O2S/c1-3-13(4-2)11-6-8-14(10-11)17(15,16)9-5-7-12/h11H,3-10,12H2,1-2H3 |
| InChIKey | VUWDZFXNDQCRPQ-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |